About N-[4-[1-(3-benzoylphenyl)ethyl]-1,3-thiazol-2-yl]-N'-methylmorpholine-4-carboximidamide
N-[4-[1-(3-benzoylphenyl)ethyl]-1,3-thiazol-2-yl]-N'-methylmorpholine-4-carboximidamide (PubChem CID 142073666) has the molecular formula C24H26N4O2S
and a molecular weight of 434.57 g/mol. Its IUPAC name is N-[4-[1-(3-benzoylphenyl)ethyl]-1,3-thiazol-2-yl]-N'-methylmorpholine-4-carboximidamide.
Molecular Properties
| Compound Name | N-[4-[1-(3-benzoylphenyl)ethyl]-1,3-thiazol-2-yl]-N'-methylmorpholine-4-carboximidamide |
| PubChem CID | 142073666 |
| Molecular Formula | C24H26N4O2S |
| Molecular Weight | 434.57 g/mol |
| Exact Mass | 434.18 |
| IUPAC Name | N-[4-[1-(3-benzoylphenyl)ethyl]-1,3-thiazol-2-yl]-N'-methylmorpholine-4-carboximidamide |
| SMILES | C/N=C(/Nc1nc(C(C)c2cccc(C(=O)c3ccccc3)c2)cs1)N1CCOCC1 |
| InChI | InChI=1S/C24H26N4O2S/c1-17(19-9-6-10-20(15-19)22(29)18-7-4-3-5-8-18)21-16-31-24(26-21)27-23(25-2)28-11-13-30-14-12-28/h3-10,15-17H,11-14H2,1-2H3,(H,25,26,27) |
| InChIKey | NSYOZQWKGMMJEJ-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 66.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 434.57 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze N-[4-[1-(3-benzoylphenyl)ethyl]-1,3-thiazol-2-yl]-N'-methylmorpholine-4-carboximidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[4-[1-(3-benzoylphenyl)ethyl]-1,3-thiazol-2-yl]-N'-methylmorpholine-4-carboximidamide?
The IUPAC name of N-[4-[1-(3-benzoylphenyl)ethyl]-1,3-thiazol-2-yl]-N'-methylmorpholine-4-carboximidamide (CID 142073666) is N-[4-[1-(3-benzoylphenyl)ethyl]-1,3-thiazol-2-yl]-N'-methylmorpholine-4-carboximidamide.
What is the SMILES notation for N-[4-[1-(3-benzoylphenyl)ethyl]-1,3-thiazol-2-yl]-N'-methylmorpholine-4-carboximidamide?
The canonical SMILES for N-[4-[1-(3-benzoylphenyl)ethyl]-1,3-thiazol-2-yl]-N'-methylmorpholine-4-carboximidamide is C/N=C(/Nc1nc(C(C)c2cccc(C(=O)c3ccccc3)c2)cs1)N1CCOCC1.
What is the InChIKey of N-[4-[1-(3-benzoylphenyl)ethyl]-1,3-thiazol-2-yl]-N'-methylmorpholine-4-carboximidamide?
The InChIKey is NSYOZQWKGMMJEJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H26N4O2S/c1-17(19-9-6-10-20(15-19)22(29)18-7-4-3-5-8-18)21-16-31-24(26-21)27-23(25-2)28-11-13-30-14-12-28/h3-10,15-17H,11-14H2,1-2H3,(H,25,26,27).
What are the key properties of N-[4-[1-(3-benzoylphenyl)ethyl]-1,3-thiazol-2-yl]-N'-methylmorpholine-4-carboximidamide?
N-[4-[1-(3-benzoylphenyl)ethyl]-1,3-thiazol-2-yl]-N'-methylmorpholine-4-carboximidamide has a molecular weight of 434.57 g/mol, XLogP of 4.26, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-[4-[1-(3-benzoylphenyl)ethyl]-1,3-thiazol-2-yl]-N'-methylmorpholine-4-carboximidamide is sourced from PubChem (CID 142073666), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).