About N'-cyano-N,N-dimethylmorpholine-4-carboximidamide
N'-cyano-N,N-dimethylmorpholine-4-carboximidamide (PubChem CID 142073757) has the molecular formula C8H14N4O
and a molecular weight of 182.23 g/mol. Its IUPAC name is N'-cyano-N,N-dimethylmorpholine-4-carboximidamide.
Molecular Properties
| Compound Name | N'-cyano-N,N-dimethylmorpholine-4-carboximidamide |
| PubChem CID | 142073757 |
| Molecular Formula | C8H14N4O |
| Molecular Weight | 182.23 g/mol |
| Exact Mass | 182.12 |
| IUPAC Name | N'-cyano-N,N-dimethylmorpholine-4-carboximidamide |
| SMILES | CN(C)/C(=N\C#N)N1CCOCC1 |
| InChI | InChI=1S/C8H14N4O/c1-11(2)8(10-7-9)12-3-5-13-6-4-12/h3-6H2,1-2H3/b10-8+ |
| InChIKey | BJFDFRSFSUDZAC-CSKARUKUSA-N |
| XLogP | -0.28 |
| TPSA | 51.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 182.23 |
| LogP ≤ 5 | -0.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze N'-cyano-N,N-dimethylmorpholine-4-carboximidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-cyano-N,N-dimethylmorpholine-4-carboximidamide?
The IUPAC name of N'-cyano-N,N-dimethylmorpholine-4-carboximidamide (CID 142073757) is N'-cyano-N,N-dimethylmorpholine-4-carboximidamide.
What is the SMILES notation for N'-cyano-N,N-dimethylmorpholine-4-carboximidamide?
The canonical SMILES for N'-cyano-N,N-dimethylmorpholine-4-carboximidamide is CN(C)/C(=N\C#N)N1CCOCC1.
What is the InChIKey of N'-cyano-N,N-dimethylmorpholine-4-carboximidamide?
The InChIKey is BJFDFRSFSUDZAC-CSKARUKUSA-N. The full InChI is InChI=1S/C8H14N4O/c1-11(2)8(10-7-9)12-3-5-13-6-4-12/h3-6H2,1-2H3/b10-8+.
What are the key properties of N'-cyano-N,N-dimethylmorpholine-4-carboximidamide?
N'-cyano-N,N-dimethylmorpholine-4-carboximidamide has a molecular weight of 182.23 g/mol, XLogP of -0.28, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N'-cyano-N,N-dimethylmorpholine-4-carboximidamide is sourced from PubChem (CID 142073757), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).