About buta-1,3-dien-2-yldiazene
buta-1,3-dien-2-yldiazene (PubChem CID 142074109) has the molecular formula C4H6N2
and a molecular weight of 82.11 g/mol. Its IUPAC name is buta-1,3-dien-2-yldiazene.
Molecular Properties
| Compound Name | buta-1,3-dien-2-yldiazene |
| PubChem CID | 142074109 |
| Molecular Formula | C4H6N2 |
| Molecular Weight | 82.11 g/mol |
| Exact Mass | 82.05 |
| IUPAC Name | buta-1,3-dien-2-yldiazene |
| SMILES | [H]/N=N/C(=C)C=C |
| InChI | InChI=1S/C4H6N2/c1-3-4(2)6-5/h3,5H,1-2H2/b6-5+ |
| InChIKey | CWKZPGUXQSVSJE-AATRIKPKSA-N |
| XLogP | 1.72 |
| TPSA | 36.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 6 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 82.11 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze buta-1,3-dien-2-yldiazene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of buta-1,3-dien-2-yldiazene?
The IUPAC name of buta-1,3-dien-2-yldiazene (CID 142074109) is buta-1,3-dien-2-yldiazene.
What is the SMILES notation for buta-1,3-dien-2-yldiazene?
The canonical SMILES for buta-1,3-dien-2-yldiazene is [H]/N=N/C(=C)C=C.
What is the InChIKey of buta-1,3-dien-2-yldiazene?
The InChIKey is CWKZPGUXQSVSJE-AATRIKPKSA-N. The full InChI is InChI=1S/C4H6N2/c1-3-4(2)6-5/h3,5H,1-2H2/b6-5+.
What are the key properties of buta-1,3-dien-2-yldiazene?
buta-1,3-dien-2-yldiazene has a molecular weight of 82.11 g/mol, XLogP of 1.72, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for buta-1,3-dien-2-yldiazene is sourced from PubChem (CID 142074109), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).