C9H10BrNO2 — CID 142074135
7-(bromomethyl)-7-methyl-3-nitrocyclohepta-1,3,5-triene (PubChem CID 142074135) has the molecular formula C9H10BrNO2 and a molecular weight of 244.09 g/mol. Its IUPAC name is 7-(bromomethyl)-7-methyl-3-nitrocyclohepta-1,3,5-triene.
| Compound Name | 7-(bromomethyl)-7-methyl-3-nitrocyclohepta-1,3,5-triene |
|---|---|
| PubChem CID | 142074135 |
| Molecular Formula | C9H10BrNO2 |
| Molecular Weight | 244.09 g/mol |
| Exact Mass | 242.99 |
| IUPAC Name | 7-(bromomethyl)-7-methyl-3-nitrocyclohepta-1,3,5-triene |
| SMILES | CC1(CBr)C=CC=C([N+](=O)[O-])C=C1 |
| InChI | InChI=1S/C9H10BrNO2/c1-9(7-10)5-2-3-8(4-6-9)11(12)13/h2-6H,7H2,1H3 |
| InChIKey | MSVUTVGAWPBZEP-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 43.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.09 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|