C21H33NO4 — CID 142074454
1-cyclopentyloxy-2-methoxybenzene;methyl 3-ethyl-3-methylpyrrolidine-1-carboxylate (PubChem CID 142074454) has the molecular formula C21H33NO4 and a molecular weight of 363.50 g/mol. Its IUPAC name is 1-cyclopentyloxy-2-methoxybenzene;methyl 3-ethyl-3-methylpyrrolidine-1-carboxylate.
| Compound Name | 1-cyclopentyloxy-2-methoxybenzene;methyl 3-ethyl-3-methylpyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 142074454 |
| Molecular Formula | C21H33NO4 |
| Molecular Weight | 363.50 g/mol |
| Exact Mass | 363.24 |
| IUPAC Name | 1-cyclopentyloxy-2-methoxybenzene;methyl 3-ethyl-3-methylpyrrolidine-1-carboxylate |
| SMILES | CCC1(C)CCN(C(=O)OC)C1.COc1ccccc1OC1CCCC1 |
| InChI | InChI=1S/C12H16O2.C9H17NO2/c1-13-11-8-4-5-9-12(11)14-10-6-2-3-7-10;1-4-9(2)5-6-10(7-9)8(11)12-3/h4-5,8-10H,2-3,6-7H2,1H3;4-7H2,1-3H3 |
| InChIKey | XMBUKJHHSHAWRR-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.50 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |