C8H18OS — CID 142075292
4-ethylsulfanyl-2,3-dimethylbutan-1-ol (PubChem CID 142075292) has the molecular formula C8H18OS and a molecular weight of 162.30 g/mol. Its IUPAC name is 4-ethylsulfanyl-2,3-dimethylbutan-1-ol.
| Compound Name | 4-ethylsulfanyl-2,3-dimethylbutan-1-ol |
|---|---|
| PubChem CID | 142075292 |
| Molecular Formula | C8H18OS |
| Molecular Weight | 162.30 g/mol |
| Exact Mass | 162.11 |
| IUPAC Name | 4-ethylsulfanyl-2,3-dimethylbutan-1-ol |
| SMILES | CCSCC(C)C(C)CO |
| InChI | InChI=1S/C8H18OS/c1-4-10-6-8(3)7(2)5-9/h7-9H,4-6H2,1-3H3 |
| InChIKey | FWPWKXXUDFJOKP-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 162.30 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |