About 4-ethylsulfanyl-2,3-dimethylbutan-1-ol
4-ethylsulfanyl-2,3-dimethylbutan-1-ol (PubChem CID 142075292) has the molecular formula C8H18OS
and a molecular weight of 162.30 g/mol. Its IUPAC name is 4-ethylsulfanyl-2,3-dimethylbutan-1-ol.
Molecular Properties
| Compound Name | 4-ethylsulfanyl-2,3-dimethylbutan-1-ol |
| PubChem CID | 142075292 |
| Molecular Formula | C8H18OS |
| Molecular Weight | 162.30 g/mol |
| Exact Mass | 162.11 |
| IUPAC Name | 4-ethylsulfanyl-2,3-dimethylbutan-1-ol |
| SMILES | CCSCC(C)C(C)CO |
| InChI | InChI=1S/C8H18OS/c1-4-10-6-8(3)7(2)5-9/h7-9H,4-6H2,1-3H3 |
| InChIKey | FWPWKXXUDFJOKP-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 162.30 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-ethylsulfanyl-2,3-dimethylbutan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-ethylsulfanyl-2,3-dimethylbutan-1-ol?
The IUPAC name of 4-ethylsulfanyl-2,3-dimethylbutan-1-ol (CID 142075292) is 4-ethylsulfanyl-2,3-dimethylbutan-1-ol.
What is the SMILES notation for 4-ethylsulfanyl-2,3-dimethylbutan-1-ol?
The canonical SMILES for 4-ethylsulfanyl-2,3-dimethylbutan-1-ol is CCSCC(C)C(C)CO.
What is the InChIKey of 4-ethylsulfanyl-2,3-dimethylbutan-1-ol?
The InChIKey is FWPWKXXUDFJOKP-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H18OS/c1-4-10-6-8(3)7(2)5-9/h7-9H,4-6H2,1-3H3.
What are the key properties of 4-ethylsulfanyl-2,3-dimethylbutan-1-ol?
4-ethylsulfanyl-2,3-dimethylbutan-1-ol has a molecular weight of 162.30 g/mol, XLogP of 2.00, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-ethylsulfanyl-2,3-dimethylbutan-1-ol is sourced from PubChem (CID 142075292), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).