C20H23ClN2O6S2 — CID 142075390
(1Z,3Z)-6-(1,3-benzodioxol-5-yl)-N-(4-chloro-3-methyl-1,2-oxazol-5-yl)-1-methylsulfanyl-5-oxohexa-1,3-diene-3-sulfonamide;ethane (PubChem CID 142075390) has the molecular formula C20H23ClN2O6S2 and a molecular weight of 487.00 g/mol. Its IUPAC name is (1Z,3Z)-6-(1,3-benzodioxol-5-yl)-N-(4-chloro-3-methyl-1,2-oxazol-5-yl)-1-methylsulfanyl-5-oxohexa-1,3-diene-3-sulfonamide;ethane.
| Compound Name | (1Z,3Z)-6-(1,3-benzodioxol-5-yl)-N-(4-chloro-3-methyl-1,2-oxazol-5-yl)-1-methylsulfanyl-5-oxohexa-1,3-diene-3-sulfonamide;ethane |
|---|---|
| PubChem CID | 142075390 |
| Molecular Formula | C20H23ClN2O6S2 |
| Molecular Weight | 487.00 g/mol |
| Exact Mass | 486.07 |
| IUPAC Name | (1Z,3Z)-6-(1,3-benzodioxol-5-yl)-N-(4-chloro-3-methyl-1,2-oxazol-5-yl)-1-methylsulfanyl-5-oxohexa-1,3-diene-3-sulfonamide;ethane |
| SMILES | CC.CS/C=C\C(=C\C(=O)Cc1ccc2c(c1)OCO2)S(=O)(=O)Nc1onc(C)c1Cl |
| InChI | InChI=1S/C18H17ClN2O6S2.C2H6/c1-11-17(19)18(27-20-11)21-29(23,24)14(5-6-28-2)9-13(22)7-12-3-4-15-16(8-12)26-10-25-15;1-2/h3-6,8-9,21H,7,10H2,1-2H3;1-2H3/b6-5-,14-9-; |
| InChIKey | QDONJDCIMXKIKS-CZUDNRFXSA-N |
| XLogP | 4.71 |
| TPSA | 107.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.00 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|