C19H20ClN5O4 — CID 1420754
6-chloro-2-N,4-N-bis(3,4-dimethoxyphenyl)-1,3,5-triazine-2,4-diamine (PubChem CID 1420754) has the molecular formula C19H20ClN5O4 and a molecular weight of 417.85 g/mol. Its IUPAC name is 6-chloro-2-N,4-N-bis(3,4-dimethoxyphenyl)-1,3,5-triazine-2,4-diamine.
| Compound Name | 6-chloro-2-N,4-N-bis(3,4-dimethoxyphenyl)-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 1420754 |
| Molecular Formula | C19H20ClN5O4 |
| Molecular Weight | 417.85 g/mol |
| Exact Mass | 417.12 |
| IUPAC Name | 6-chloro-2-N,4-N-bis(3,4-dimethoxyphenyl)-1,3,5-triazine-2,4-diamine |
| SMILES | COc1ccc(Nc2nc(Cl)nc(Nc3ccc(OC)c(OC)c3)n2)cc1OC |
| InChI | InChI=1S/C19H20ClN5O4/c1-26-13-7-5-11(9-15(13)28-3)21-18-23-17(20)24-19(25-18)22-12-6-8-14(27-2)16(10-12)29-4/h5-10H,1-4H3,(H2,21,22,23,24,25) |
| InChIKey | GNOOBBKCLFWMMS-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 99.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.85 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |