C14H20N2O2 — CID 142075644
acetaldehyde;1-methyl-4-(methylamino)-1,2,4,7-tetrahydrocyclohepta[c]pyridin-3-one (PubChem CID 142075644) has the molecular formula C14H20N2O2 and a molecular weight of 248.33 g/mol. Its IUPAC name is acetaldehyde;1-methyl-4-(methylamino)-1,2,4,7-tetrahydrocyclohepta[c]pyridin-3-one.
| Compound Name | acetaldehyde;1-methyl-4-(methylamino)-1,2,4,7-tetrahydrocyclohepta[c]pyridin-3-one |
|---|---|
| PubChem CID | 142075644 |
| Molecular Formula | C14H20N2O2 |
| Molecular Weight | 248.33 g/mol |
| Exact Mass | 248.15 |
| IUPAC Name | acetaldehyde;1-methyl-4-(methylamino)-1,2,4,7-tetrahydrocyclohepta[c]pyridin-3-one |
| SMILES | CC=O.CNC1C(=O)NC(C)C2=C1C=CCC=C2 |
| InChI | InChI=1S/C12H16N2O.C2H4O/c1-8-9-6-4-3-5-7-10(9)11(13-2)12(15)14-8;1-2-3/h4-8,11,13H,3H2,1-2H3,(H,14,15);2H,1H3 |
| InChIKey | PWFSGOGDOAYGPC-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.33 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|