C37H38ClN5O2 — CID 142076418
4-(3-chlorophenyl)-1-(cyclopropylmethyl)-6-[2-methanimidoyl-1-[(4-methoxyphenyl)methylamino]-1-(3-methylimidazol-4-yl)pent-4-enyl]quinolin-2-one (PubChem CID 142076418) has the molecular formula C37H38ClN5O2 and a molecular weight of 620.20 g/mol. Its IUPAC name is 4-(3-chlorophenyl)-1-(cyclopropylmethyl)-6-[2-methanimidoyl-1-[(4-methoxyphenyl)methylamino]-1-(3-methylimidazol-4-yl)pent-4-enyl]quinolin-2-one.
| Compound Name | 4-(3-chlorophenyl)-1-(cyclopropylmethyl)-6-[2-methanimidoyl-1-[(4-methoxyphenyl)methylamino]-1-(3-methylimidazol-4-yl)pent-4-enyl]quinolin-2-one |
|---|---|
| PubChem CID | 142076418 |
| Molecular Formula | C37H38ClN5O2 |
| Molecular Weight | 620.20 g/mol |
| Exact Mass | 619.27 |
| IUPAC Name | 4-(3-chlorophenyl)-1-(cyclopropylmethyl)-6-[2-methanimidoyl-1-[(4-methoxyphenyl)methylamino]-1-(3-methylimidazol-4-yl)pent-4-enyl]quinolin-2-one |
| SMILES | [H]/N=C/C(CC=C)C(NCc1ccc(OC)cc1)(c1ccc2c(c1)c(-c1cccc(Cl)c1)cc(=O)n2CC1CC1)c1cncn1C |
| InChI | InChI=1S/C37H38ClN5O2/c1-4-6-29(20-39)37(35-22-40-24-42(35)2,41-21-25-11-14-31(45-3)15-12-25)28-13-16-34-33(18-28)32(27-7-5-8-30(38)17-27)19-36(44)43(34)23-26-9-10-26/h4-5,7-8,11-20,22,24,26,29,39,41H,1,6,9-10,21,23H2,2-3H3/b39-20+ |
| InChIKey | ZJNASTGRZBVGIO-JOXMEQDKSA-N |
| XLogP | 7.35 |
| TPSA | 84.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 620.20 |
| LogP ≤ 5 | 7.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|