C24H33F3N4OS — CID 142076590
2-propan-2-yl-2-thiophen-2-yl-5-[4-[2-[(1E,3E)-5,5,5-trifluoro-1-(methylideneamino)penta-1,3-dienoxy]ethyl]piperazin-1-yl]pentanenitrile (PubChem CID 142076590) has the molecular formula C24H33F3N4OS and a molecular weight of 482.62 g/mol. Its IUPAC name is 2-propan-2-yl-2-thiophen-2-yl-5-[4-[2-[(1E,3E)-5,5,5-trifluoro-1-(methylideneamino)penta-1,3-dienoxy]ethyl]piperazin-1-yl]pentanenitrile.
| Compound Name | 2-propan-2-yl-2-thiophen-2-yl-5-[4-[2-[(1E,3E)-5,5,5-trifluoro-1-(methylideneamino)penta-1,3-dienoxy]ethyl]piperazin-1-yl]pentanenitrile |
|---|---|
| PubChem CID | 142076590 |
| Molecular Formula | C24H33F3N4OS |
| Molecular Weight | 482.62 g/mol |
| Exact Mass | 482.23 |
| IUPAC Name | 2-propan-2-yl-2-thiophen-2-yl-5-[4-[2-[(1E,3E)-5,5,5-trifluoro-1-(methylideneamino)penta-1,3-dienoxy]ethyl]piperazin-1-yl]pentanenitrile |
| SMILES | C=N/C(=C\C=C\C(F)(F)F)OCCN1CCN(CCCC(C#N)(c2cccs2)C(C)C)CC1 |
| InChI | InChI=1S/C24H33F3N4OS/c1-20(2)23(19-28,21-7-5-18-33-21)9-6-11-30-12-14-31(15-13-30)16-17-32-22(29-3)8-4-10-24(25,26)27/h4-5,7-8,10,18,20H,3,6,9,11-17H2,1-2H3/b10-4+,22-8+ |
| InChIKey | WPEOBCNPZFVUCY-CWBPBVRDSA-N |
| XLogP | 5.24 |
| TPSA | 51.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.62 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|