About tert-butyl N-ethyl-N-(N'-ethylcarbamimidoyl)carbamate;ethane
tert-butyl N-ethyl-N-(N'-ethylcarbamimidoyl)carbamate;ethane (PubChem CID 142077527) has the molecular formula C12H27N3O2
and a molecular weight of 245.37 g/mol. Its IUPAC name is tert-butyl N-ethyl-N-(N'-ethylcarbamimidoyl)carbamate;ethane.
Molecular Properties
| Compound Name | tert-butyl N-ethyl-N-(N'-ethylcarbamimidoyl)carbamate;ethane |
| PubChem CID | 142077527 |
| Molecular Formula | C12H27N3O2 |
| Molecular Weight | 245.37 g/mol |
| Exact Mass | 245.21 |
| IUPAC Name | tert-butyl N-ethyl-N-(N'-ethylcarbamimidoyl)carbamate;ethane |
| SMILES | CC.CC/N=C(\N)N(CC)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C10H21N3O2.C2H6/c1-6-12-8(11)13(7-2)9(14)15-10(3,4)5;1-2/h6-7H2,1-5H3,(H2,11,12);1-2H3 |
| InChIKey | URENZFHLIJXGRX-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 67.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 245.37 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze tert-butyl N-ethyl-N-(N'-ethylcarbamimidoyl)carbamate;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl N-ethyl-N-(N'-ethylcarbamimidoyl)carbamate;ethane?
The IUPAC name of tert-butyl N-ethyl-N-(N'-ethylcarbamimidoyl)carbamate;ethane (CID 142077527) is tert-butyl N-ethyl-N-(N'-ethylcarbamimidoyl)carbamate;ethane.
What is the SMILES notation for tert-butyl N-ethyl-N-(N'-ethylcarbamimidoyl)carbamate;ethane?
The canonical SMILES for tert-butyl N-ethyl-N-(N'-ethylcarbamimidoyl)carbamate;ethane is CC.CC/N=C(\N)N(CC)C(=O)OC(C)(C)C.
What is the InChIKey of tert-butyl N-ethyl-N-(N'-ethylcarbamimidoyl)carbamate;ethane?
The InChIKey is URENZFHLIJXGRX-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H21N3O2.C2H6/c1-6-12-8(11)13(7-2)9(14)15-10(3,4)5;1-2/h6-7H2,1-5H3,(H2,11,12);1-2H3.
What are the key properties of tert-butyl N-ethyl-N-(N'-ethylcarbamimidoyl)carbamate;ethane?
tert-butyl N-ethyl-N-(N'-ethylcarbamimidoyl)carbamate;ethane has a molecular weight of 245.37 g/mol, XLogP of 2.60, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl N-ethyl-N-(N'-ethylcarbamimidoyl)carbamate;ethane is sourced from PubChem (CID 142077527), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).