About (4S)-4-[[2,3-bis(ethenyl)phenyl]methyl]-2,2-dimethylimidazolidine
(4S)-4-[[2,3-bis(ethenyl)phenyl]methyl]-2,2-dimethylimidazolidine (PubChem CID 142077573) has the molecular formula C16H22N2
and a molecular weight of 242.37 g/mol. Its IUPAC name is (4S)-4-[[2,3-bis(ethenyl)phenyl]methyl]-2,2-dimethylimidazolidine.
Molecular Properties
| Compound Name | (4S)-4-[[2,3-bis(ethenyl)phenyl]methyl]-2,2-dimethylimidazolidine |
| PubChem CID | 142077573 |
| Molecular Formula | C16H22N2 |
| Molecular Weight | 242.37 g/mol |
| Exact Mass | 242.18 |
| IUPAC Name | (4S)-4-[[2,3-bis(ethenyl)phenyl]methyl]-2,2-dimethylimidazolidine |
| SMILES | C=Cc1cccc(C[C@H]2CNC(C)(C)N2)c1C=C |
| InChI | InChI=1S/C16H22N2/c1-5-12-8-7-9-13(15(12)6-2)10-14-11-17-16(3,4)18-14/h5-9,14,17-18H,1-2,10-11H2,3-4H3/t14-/m0/s1 |
| InChIKey | KOIKOIHOLISGMD-AWEZNQCLSA-N |
| XLogP | 2.81 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 242.37 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (4S)-4-[[2,3-bis(ethenyl)phenyl]methyl]-2,2-dimethylimidazolidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4S)-4-[[2,3-bis(ethenyl)phenyl]methyl]-2,2-dimethylimidazolidine?
The IUPAC name of (4S)-4-[[2,3-bis(ethenyl)phenyl]methyl]-2,2-dimethylimidazolidine (CID 142077573) is (4S)-4-[[2,3-bis(ethenyl)phenyl]methyl]-2,2-dimethylimidazolidine.
What is the SMILES notation for (4S)-4-[[2,3-bis(ethenyl)phenyl]methyl]-2,2-dimethylimidazolidine?
The canonical SMILES for (4S)-4-[[2,3-bis(ethenyl)phenyl]methyl]-2,2-dimethylimidazolidine is C=Cc1cccc(C[C@H]2CNC(C)(C)N2)c1C=C.
What is the InChIKey of (4S)-4-[[2,3-bis(ethenyl)phenyl]methyl]-2,2-dimethylimidazolidine?
The InChIKey is KOIKOIHOLISGMD-AWEZNQCLSA-N. The full InChI is InChI=1S/C16H22N2/c1-5-12-8-7-9-13(15(12)6-2)10-14-11-17-16(3,4)18-14/h5-9,14,17-18H,1-2,10-11H2,3-4H3/t14-/m0/s1.
What are the key properties of (4S)-4-[[2,3-bis(ethenyl)phenyl]methyl]-2,2-dimethylimidazolidine?
(4S)-4-[[2,3-bis(ethenyl)phenyl]methyl]-2,2-dimethylimidazolidine has a molecular weight of 242.37 g/mol, XLogP of 2.81, 4 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (4S)-4-[[2,3-bis(ethenyl)phenyl]methyl]-2,2-dimethylimidazolidine is sourced from PubChem (CID 142077573), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).