About ethane;5-methoxy-1,2-dimethyl-2-propylimidazolidine;2-methylpropane
ethane;5-methoxy-1,2-dimethyl-2-propylimidazolidine;2-methylpropane (PubChem CID 142077593) has the molecular formula C15H36N2O
and a molecular weight of 260.47 g/mol. Its IUPAC name is ethane;5-methoxy-1,2-dimethyl-2-propylimidazolidine;2-methylpropane.
Molecular Properties
| Compound Name | ethane;5-methoxy-1,2-dimethyl-2-propylimidazolidine;2-methylpropane |
| PubChem CID | 142077593 |
| Molecular Formula | C15H36N2O |
| Molecular Weight | 260.47 g/mol |
| Exact Mass | 260.28 |
| IUPAC Name | ethane;5-methoxy-1,2-dimethyl-2-propylimidazolidine;2-methylpropane |
| SMILES | CC.CC(C)C.CCCC1(C)NCC(OC)N1C |
| InChI | InChI=1S/C9H20N2O.C4H10.C2H6/c1-5-6-9(2)10-7-8(12-4)11(9)3;1-4(2)3;1-2/h8,10H,5-7H2,1-4H3;4H,1-3H3;1-2H3 |
| InChIKey | XSLNAZBJVQWCAQ-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 260.47 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze ethane;5-methoxy-1,2-dimethyl-2-propylimidazolidine;2-methylpropane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;5-methoxy-1,2-dimethyl-2-propylimidazolidine;2-methylpropane?
The IUPAC name of ethane;5-methoxy-1,2-dimethyl-2-propylimidazolidine;2-methylpropane (CID 142077593) is ethane;5-methoxy-1,2-dimethyl-2-propylimidazolidine;2-methylpropane.
What is the SMILES notation for ethane;5-methoxy-1,2-dimethyl-2-propylimidazolidine;2-methylpropane?
The canonical SMILES for ethane;5-methoxy-1,2-dimethyl-2-propylimidazolidine;2-methylpropane is CC.CC(C)C.CCCC1(C)NCC(OC)N1C.
What is the InChIKey of ethane;5-methoxy-1,2-dimethyl-2-propylimidazolidine;2-methylpropane?
The InChIKey is XSLNAZBJVQWCAQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H20N2O.C4H10.C2H6/c1-5-6-9(2)10-7-8(12-4)11(9)3;1-4(2)3;1-2/h8,10H,5-7H2,1-4H3;4H,1-3H3;1-2H3.
What are the key properties of ethane;5-methoxy-1,2-dimethyl-2-propylimidazolidine;2-methylpropane?
ethane;5-methoxy-1,2-dimethyl-2-propylimidazolidine;2-methylpropane has a molecular weight of 260.47 g/mol, XLogP of 3.70, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;5-methoxy-1,2-dimethyl-2-propylimidazolidine;2-methylpropane is sourced from PubChem (CID 142077593), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).