C17H20O — CID 142077651
1-ethyl-3,5-dimethyl-2-phenylmethoxybenzene (PubChem CID 142077651) has the molecular formula C17H20O and a molecular weight of 240.35 g/mol. Its IUPAC name is 1-ethyl-3,5-dimethyl-2-phenylmethoxybenzene.
| Compound Name | 1-ethyl-3,5-dimethyl-2-phenylmethoxybenzene |
|---|---|
| PubChem CID | 142077651 |
| Molecular Formula | C17H20O |
| Molecular Weight | 240.35 g/mol |
| Exact Mass | 240.15 |
| IUPAC Name | 1-ethyl-3,5-dimethyl-2-phenylmethoxybenzene |
| SMILES | CCc1cc(C)cc(C)c1OCc1ccccc1 |
| InChI | InChI=1S/C17H20O/c1-4-16-11-13(2)10-14(3)17(16)18-12-15-8-6-5-7-9-15/h5-11H,4,12H2,1-3H3 |
| InChIKey | XJCMJIMJTCXKFA-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.35 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |