C13H21Br2N2O2P — CID 142077695
1,3-dibromo-2-methoxy-5-methylbenzene;1-methoxy-5,5-dimethyl-1,4,2-diazaphospholidine (PubChem CID 142077695) has the molecular formula C13H21Br2N2O2P and a molecular weight of 428.11 g/mol. Its IUPAC name is 1,3-dibromo-2-methoxy-5-methylbenzene;1-methoxy-5,5-dimethyl-1,4,2-diazaphospholidine.
| Compound Name | 1,3-dibromo-2-methoxy-5-methylbenzene;1-methoxy-5,5-dimethyl-1,4,2-diazaphospholidine |
|---|---|
| PubChem CID | 142077695 |
| Molecular Formula | C13H21Br2N2O2P |
| Molecular Weight | 428.11 g/mol |
| Exact Mass | 425.97 |
| IUPAC Name | 1,3-dibromo-2-methoxy-5-methylbenzene;1-methoxy-5,5-dimethyl-1,4,2-diazaphospholidine |
| SMILES | CON1PCNC1(C)C.COc1c(Br)cc(C)cc1Br |
| InChI | InChI=1S/C8H8Br2O.C5H13N2OP/c1-5-3-6(9)8(11-2)7(10)4-5;1-5(2)6-4-9-7(5)8-3/h3-4H,1-2H3;6,9H,4H2,1-3H3 |
| InChIKey | UDCOWZVKMUILLE-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 33.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.11 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|