C15H27N3O — CID 142077705
(2E,4Z)-2,5-dimethylhepta-2,4-dienenitrile;1-methoxy-2,2-dimethylimidazolidine (PubChem CID 142077705) has the molecular formula C15H27N3O and a molecular weight of 265.40 g/mol. Its IUPAC name is (2E,4Z)-2,5-dimethylhepta-2,4-dienenitrile;1-methoxy-2,2-dimethylimidazolidine.
| Compound Name | (2E,4Z)-2,5-dimethylhepta-2,4-dienenitrile;1-methoxy-2,2-dimethylimidazolidine |
|---|---|
| PubChem CID | 142077705 |
| Molecular Formula | C15H27N3O |
| Molecular Weight | 265.40 g/mol |
| Exact Mass | 265.22 |
| IUPAC Name | (2E,4Z)-2,5-dimethylhepta-2,4-dienenitrile;1-methoxy-2,2-dimethylimidazolidine |
| SMILES | CC/C(C)=C\C=C(/C)C#N.CON1CCNC1(C)C |
| InChI | InChI=1S/C9H13N.C6H14N2O/c1-4-8(2)5-6-9(3)7-10;1-6(2)7-4-5-8(6)9-3/h5-6H,4H2,1-3H3;7H,4-5H2,1-3H3/b8-5-,9-6+; |
| InChIKey | ZMFHDHRIRHMWHV-BJHRKZFFSA-N |
| XLogP | 3.00 |
| TPSA | 48.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.40 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|