About 2,2-dimethyl-1,3-oxazolidine;2-methylbutane
2,2-dimethyl-1,3-oxazolidine;2-methylbutane (PubChem CID 142077716) has the molecular formula C10H23NO
and a molecular weight of 173.30 g/mol. Its IUPAC name is 2,2-dimethyl-1,3-oxazolidine;2-methylbutane.
Molecular Properties
| Compound Name | 2,2-dimethyl-1,3-oxazolidine;2-methylbutane |
| PubChem CID | 142077716 |
| Molecular Formula | C10H23NO |
| Molecular Weight | 173.30 g/mol |
| Exact Mass | 173.18 |
| IUPAC Name | 2,2-dimethyl-1,3-oxazolidine;2-methylbutane |
| SMILES | CC1(C)NCCO1.CCC(C)C |
| InChI | InChI=1S/C5H11NO.C5H12/c1-5(2)6-3-4-7-5;1-4-5(2)3/h6H,3-4H2,1-2H3;5H,4H2,1-3H3 |
| InChIKey | GICOORSEHQXLRA-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 173.30 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2,2-dimethyl-1,3-oxazolidine;2-methylbutane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,2-dimethyl-1,3-oxazolidine;2-methylbutane?
The IUPAC name of 2,2-dimethyl-1,3-oxazolidine;2-methylbutane (CID 142077716) is 2,2-dimethyl-1,3-oxazolidine;2-methylbutane.
What is the SMILES notation for 2,2-dimethyl-1,3-oxazolidine;2-methylbutane?
The canonical SMILES for 2,2-dimethyl-1,3-oxazolidine;2-methylbutane is CC1(C)NCCO1.CCC(C)C.
What is the InChIKey of 2,2-dimethyl-1,3-oxazolidine;2-methylbutane?
The InChIKey is GICOORSEHQXLRA-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H11NO.C5H12/c1-5(2)6-3-4-7-5;1-4-5(2)3/h6H,3-4H2,1-2H3;5H,4H2,1-3H3.
What are the key properties of 2,2-dimethyl-1,3-oxazolidine;2-methylbutane?
2,2-dimethyl-1,3-oxazolidine;2-methylbutane has a molecular weight of 173.30 g/mol, XLogP of 2.39, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2,2-dimethyl-1,3-oxazolidine;2-methylbutane is sourced from PubChem (CID 142077716), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).