About 4-methylaniline;1-methylimidazolidine
4-methylaniline;1-methylimidazolidine (PubChem CID 142077719) has the molecular formula C11H19N3
and a molecular weight of 193.29 g/mol. Its IUPAC name is 4-methylaniline;1-methylimidazolidine.
Molecular Properties
| Compound Name | 4-methylaniline;1-methylimidazolidine |
| PubChem CID | 142077719 |
| Molecular Formula | C11H19N3 |
| Molecular Weight | 193.29 g/mol |
| Exact Mass | 193.16 |
| IUPAC Name | 4-methylaniline;1-methylimidazolidine |
| SMILES | CN1CCNC1.Cc1ccc(N)cc1 |
| InChI | InChI=1S/C7H9N.C4H10N2/c1-6-2-4-7(8)5-3-6;1-6-3-2-5-4-6/h2-5H,8H2,1H3;5H,2-4H2,1H3 |
| InChIKey | DAJQEACXTMCDBA-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 41.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 193.29 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 4-methylaniline;1-methylimidazolidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methylaniline;1-methylimidazolidine?
The IUPAC name of 4-methylaniline;1-methylimidazolidine (CID 142077719) is 4-methylaniline;1-methylimidazolidine.
What is the SMILES notation for 4-methylaniline;1-methylimidazolidine?
The canonical SMILES for 4-methylaniline;1-methylimidazolidine is CN1CCNC1.Cc1ccc(N)cc1.
What is the InChIKey of 4-methylaniline;1-methylimidazolidine?
The InChIKey is DAJQEACXTMCDBA-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H9N.C4H10N2/c1-6-2-4-7(8)5-3-6;1-6-3-2-5-4-6/h2-5H,8H2,1H3;5H,2-4H2,1H3.
What are the key properties of 4-methylaniline;1-methylimidazolidine?
4-methylaniline;1-methylimidazolidine has a molecular weight of 193.29 g/mol, XLogP of 1.06, 0 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methylaniline;1-methylimidazolidine is sourced from PubChem (CID 142077719), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).