C19H14ClN5O5 — CID 14207780
N-[[3-(6-chloropyridazin-3-yl)oxy-4-methylphenyl]carbamoyl]-2-nitrobenzamide (PubChem CID 14207780) has the molecular formula C19H14ClN5O5 and a molecular weight of 427.80 g/mol. Its IUPAC name is N-[[3-(6-chloropyridazin-3-yl)oxy-4-methylphenyl]carbamoyl]-2-nitrobenzamide.
| Compound Name | N-[[3-(6-chloropyridazin-3-yl)oxy-4-methylphenyl]carbamoyl]-2-nitrobenzamide |
|---|---|
| PubChem CID | 14207780 |
| Molecular Formula | C19H14ClN5O5 |
| Molecular Weight | 427.80 g/mol |
| Exact Mass | 427.07 |
| IUPAC Name | N-[[3-(6-chloropyridazin-3-yl)oxy-4-methylphenyl]carbamoyl]-2-nitrobenzamide |
| SMILES | Cc1ccc(NC(=O)NC(=O)c2ccccc2[N+](=O)[O-])cc1Oc1ccc(Cl)nn1 |
| InChI | InChI=1S/C19H14ClN5O5/c1-11-6-7-12(10-15(11)30-17-9-8-16(20)23-24-17)21-19(27)22-18(26)13-4-2-3-5-14(13)25(28)29/h2-10H,1H3,(H2,21,22,26,27) |
| InChIKey | ICFNFXPFHSXKBT-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 136.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.80 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|