C8H12F3N — CID 142077871
(3E,5E)-7,7,7-trifluoro-6-methylhepta-3,5-dien-3-amine (PubChem CID 142077871) has the molecular formula C8H12F3N and a molecular weight of 179.19 g/mol. Its IUPAC name is (3E,5E)-7,7,7-trifluoro-6-methylhepta-3,5-dien-3-amine.
| Compound Name | (3E,5E)-7,7,7-trifluoro-6-methylhepta-3,5-dien-3-amine |
|---|---|
| PubChem CID | 142077871 |
| Molecular Formula | C8H12F3N |
| Molecular Weight | 179.19 g/mol |
| Exact Mass | 179.09 |
| IUPAC Name | (3E,5E)-7,7,7-trifluoro-6-methylhepta-3,5-dien-3-amine |
| SMILES | CC/C(N)=C\C=C(/C)C(F)(F)F |
| InChI | InChI=1S/C8H12F3N/c1-3-7(12)5-4-6(2)8(9,10)11/h4-5H,3,12H2,1-2H3/b6-4+,7-5+ |
| InChIKey | CYQKKXJINNSKMP-YDFGWWAZSA-N |
| XLogP | 2.75 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.19 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|