C13H20N+ — CID 142078556
ethyl-[(2E)-3-methylpenta-2,4-dienylidene]-[(1E,3Z)-penta-1,3-dienyl]azanium (PubChem CID 142078556) has the molecular formula C13H20N+ and a molecular weight of 190.31 g/mol. Its IUPAC name is ethyl-[(2E)-3-methylpenta-2,4-dienylidene]-[(1E,3Z)-penta-1,3-dienyl]azanium.
| Compound Name | ethyl-[(2E)-3-methylpenta-2,4-dienylidene]-[(1E,3Z)-penta-1,3-dienyl]azanium |
|---|---|
| PubChem CID | 142078556 |
| Molecular Formula | C13H20N+ |
| Molecular Weight | 190.31 g/mol |
| Exact Mass | 190.16 |
| IUPAC Name | ethyl-[(2E)-3-methylpenta-2,4-dienylidene]-[(1E,3Z)-penta-1,3-dienyl]azanium |
| SMILES | C=C/C(C)=C/C=[N+](/C=C/C=C\C)CC |
| InChI | InChI=1S/C13H20N/c1-5-8-9-11-14(7-3)12-10-13(4)6-2/h5-6,8-12H,2,7H2,1,3-4H3/q+1/b8-5-,11-9+,13-10+,14-12+ |
| InChIKey | UKEINUQIUHWRGJ-DNPSLHRXSA-N |
| XLogP | 3.31 |
| TPSA | 3.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.31 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|