C25H33NO6 — CID 142078601
(2Z,4Z)-N-[(E)-3-[(6E)-7-ethenyl-11-hydroxy-6-(1-hydroxyethenyl)-5-oxo-4,13-dioxabicyclo[7.3.1]tridec-6-en-3-yl]prop-1-enyl]hepta-2,4-dienamide (PubChem CID 142078601) has the molecular formula C25H33NO6 and a molecular weight of 443.54 g/mol. Its IUPAC name is (2Z,4Z)-N-[(E)-3-[(6E)-7-ethenyl-11-hydroxy-6-(1-hydroxyethenyl)-5-oxo-4,13-dioxabicyclo[7.3.1]tridec-6-en-3-yl]prop-1-enyl]hepta-2,4-dienamide.
| Compound Name | (2Z,4Z)-N-[(E)-3-[(6E)-7-ethenyl-11-hydroxy-6-(1-hydroxyethenyl)-5-oxo-4,13-dioxabicyclo[7.3.1]tridec-6-en-3-yl]prop-1-enyl]hepta-2,4-dienamide |
|---|---|
| PubChem CID | 142078601 |
| Molecular Formula | C25H33NO6 |
| Molecular Weight | 443.54 g/mol |
| Exact Mass | 443.23 |
| IUPAC Name | (2Z,4Z)-N-[(E)-3-[(6E)-7-ethenyl-11-hydroxy-6-(1-hydroxyethenyl)-5-oxo-4,13-dioxabicyclo[7.3.1]tridec-6-en-3-yl]prop-1-enyl]hepta-2,4-dienamide |
| SMILES | C=C/C1=C(\C(=C)O)C(=O)OC(C/C=C/NC(=O)/C=C\C=C/CC)CC2CC(O)CC(C1)O2 |
| InChI | InChI=1S/C25H33NO6/c1-4-6-7-8-11-23(29)26-12-9-10-20-16-22-15-19(28)14-21(31-22)13-18(5-2)24(17(3)27)25(30)32-20/h5-9,11-12,19-22,27-28H,2-4,10,13-16H2,1H3,(H,26,29)/b7-6-,11-8-,12-9+,24-18- |
| InChIKey | FDACRRODYJDBFJ-XBQFBQRCSA-N |
| XLogP | 3.70 |
| TPSA | 105.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.54 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|