C30H52O — CID 142078619
15-[(2R)-5-ethyl-6-methylheptan-2-yl]-2,16-dimethyltetracyclo[9.7.0.02,8.012,16]octadec-8-en-6-ol (PubChem CID 142078619) has the molecular formula C30H52O and a molecular weight of 428.75 g/mol. Its IUPAC name is 15-[(2R)-5-ethyl-6-methylheptan-2-yl]-2,16-dimethyltetracyclo[9.7.0.02,8.012,16]octadec-8-en-6-ol.
| Compound Name | 15-[(2R)-5-ethyl-6-methylheptan-2-yl]-2,16-dimethyltetracyclo[9.7.0.02,8.012,16]octadec-8-en-6-ol |
|---|---|
| PubChem CID | 142078619 |
| Molecular Formula | C30H52O |
| Molecular Weight | 428.75 g/mol |
| Exact Mass | 428.40 |
| IUPAC Name | 15-[(2R)-5-ethyl-6-methylheptan-2-yl]-2,16-dimethyltetracyclo[9.7.0.02,8.012,16]octadec-8-en-6-ol |
| SMILES | CCC(CC[C@@H](C)C1CCC2C3CC=C4CC(O)CCCC4(C)C3CCC21C)C(C)C |
| InChI | InChI=1S/C30H52O/c1-7-22(20(2)3)11-10-21(4)26-14-15-27-25-13-12-23-19-24(31)9-8-17-29(23,5)28(25)16-18-30(26,27)6/h12,20-22,24-28,31H,7-11,13-19H2,1-6H3/t21-,22?,24?,25?,26?,27?,28?,29?,30?/m1/s1 |
| InChIKey | BMQGFDGOECODPE-GSUSVCNYSA-N |
| XLogP | 8.41 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.75 |
| LogP ≤ 5 | 8.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|