About 1,6-dihydrocyclohepta[d]pyrazole;ethane
1,6-dihydrocyclohepta[d]pyrazole;ethane (PubChem CID 142078818) has the molecular formula C10H14N2
and a molecular weight of 162.24 g/mol. Its IUPAC name is 1,6-dihydrocyclohepta[d]pyrazole;ethane.
Molecular Properties
| Compound Name | 1,6-dihydrocyclohepta[d]pyrazole;ethane |
| PubChem CID | 142078818 |
| Molecular Formula | C10H14N2 |
| Molecular Weight | 162.24 g/mol |
| Exact Mass | 162.12 |
| IUPAC Name | 1,6-dihydrocyclohepta[d]pyrazole;ethane |
| SMILES | C1=Cc2cn[nH]c2C=CC1.CC |
| InChI | InChI=1S/C8H8N2.C2H6/c1-2-4-7-6-9-10-8(7)5-3-1;1-2/h2-6H,1H2,(H,9,10);1-2H3 |
| InChIKey | QRZLUJTWSNYMOF-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 162.24 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1,6-dihydrocyclohepta[d]pyrazole;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,6-dihydrocyclohepta[d]pyrazole;ethane?
The IUPAC name of 1,6-dihydrocyclohepta[d]pyrazole;ethane (CID 142078818) is 1,6-dihydrocyclohepta[d]pyrazole;ethane.
What is the SMILES notation for 1,6-dihydrocyclohepta[d]pyrazole;ethane?
The canonical SMILES for 1,6-dihydrocyclohepta[d]pyrazole;ethane is C1=Cc2cn[nH]c2C=CC1.CC.
What is the InChIKey of 1,6-dihydrocyclohepta[d]pyrazole;ethane?
The InChIKey is QRZLUJTWSNYMOF-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8N2.C2H6/c1-2-4-7-6-9-10-8(7)5-3-1;1-2/h2-6H,1H2,(H,9,10);1-2H3.
What are the key properties of 1,6-dihydrocyclohepta[d]pyrazole;ethane?
1,6-dihydrocyclohepta[d]pyrazole;ethane has a molecular weight of 162.24 g/mol, XLogP of 2.87, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1,6-dihydrocyclohepta[d]pyrazole;ethane is sourced from PubChem (CID 142078818), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).