5-methoxycarbonyl-4,4-dimethylheptanoic acid

C11H20O4 — CID 142079394

IUPAC5-methoxycarbonyl-4,4-dimethylheptanoic acid
SMILESCCC(C(=O)OC)C(C)(C)CCC(=O)O
InChIInChI=1S/C11H20O4/c1-5-8(10(14)15-4)11(2,3)7-6-9(12)13/h8H,5-7H2,1-4H3,(H,12,13)
InChIKeyDZJQYUXJPFHHNI-UHFFFAOYSA-N
MW216.28 g/mol
LogP2.08
Rot. Bonds6

About 5-methoxycarbonyl-4,4-dimethylheptanoic acid

5-methoxycarbonyl-4,4-dimethylheptanoic acid (PubChem CID 142079394) has the molecular formula C11H20O4 and a molecular weight of 216.28 g/mol. Its IUPAC name is 5-methoxycarbonyl-4,4-dimethylheptanoic acid.

Molecular Properties

Compound Name5-methoxycarbonyl-4,4-dimethylheptanoic acid
PubChem CID142079394
Molecular FormulaC11H20O4
Molecular Weight216.28 g/mol
Exact Mass216.14
IUPAC Name5-methoxycarbonyl-4,4-dimethylheptanoic acid
SMILESCCC(C(=O)OC)C(C)(C)CCC(=O)O
InChIInChI=1S/C11H20O4/c1-5-8(10(14)15-4)11(2,3)7-6-9(12)13/h8H,5-7H2,1-4H3,(H,12,13)
InChIKeyDZJQYUXJPFHHNI-UHFFFAOYSA-N
XLogP2.08
TPSA63.60 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds6
Heavy Atoms15
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500216.28
LogP ≤ 52.08
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze 5-methoxycarbonyl-4,4-dimethylheptanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 5-methoxycarbonyl-4,4-dimethylheptanoic acid?
The IUPAC name of 5-methoxycarbonyl-4,4-dimethylheptanoic acid (CID 142079394) is 5-methoxycarbonyl-4,4-dimethylheptanoic acid.
What is the SMILES notation for 5-methoxycarbonyl-4,4-dimethylheptanoic acid?
The canonical SMILES for 5-methoxycarbonyl-4,4-dimethylheptanoic acid is CCC(C(=O)OC)C(C)(C)CCC(=O)O.
What is the InChIKey of 5-methoxycarbonyl-4,4-dimethylheptanoic acid?
The InChIKey is DZJQYUXJPFHHNI-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H20O4/c1-5-8(10(14)15-4)11(2,3)7-6-9(12)13/h8H,5-7H2,1-4H3,(H,12,13).
What are the key properties of 5-methoxycarbonyl-4,4-dimethylheptanoic acid?
5-methoxycarbonyl-4,4-dimethylheptanoic acid has a molecular weight of 216.28 g/mol, XLogP of 2.08, 6 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-methoxycarbonyl-4,4-dimethylheptanoic acid is sourced from PubChem (CID 142079394), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).