C11H14S — CID 142079801
3,5-dimethyl-2-[(1Z)-2-methylbuta-1,3-dienyl]thiophene (PubChem CID 142079801) has the molecular formula C11H14S and a molecular weight of 178.30 g/mol. Its IUPAC name is 3,5-dimethyl-2-[(1Z)-2-methylbuta-1,3-dienyl]thiophene.
| Compound Name | 3,5-dimethyl-2-[(1Z)-2-methylbuta-1,3-dienyl]thiophene |
|---|---|
| PubChem CID | 142079801 |
| Molecular Formula | C11H14S |
| Molecular Weight | 178.30 g/mol |
| Exact Mass | 178.08 |
| IUPAC Name | 3,5-dimethyl-2-[(1Z)-2-methylbuta-1,3-dienyl]thiophene |
| SMILES | C=C/C(C)=C\c1sc(C)cc1C |
| InChI | InChI=1S/C11H14S/c1-5-8(2)6-11-9(3)7-10(4)12-11/h5-7H,1H2,2-4H3/b8-6- |
| InChIKey | MUYXIHVCQHNUEG-VURMDHGXSA-N |
| XLogP | 3.95 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.30 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|