About ethane;(Z)-N-ethyl-2-methyl-N'-methylideneprop-2-ene-1,3-diimine
ethane;(Z)-N-ethyl-2-methyl-N'-methylideneprop-2-ene-1,3-diimine (PubChem CID 142079882) has the molecular formula C9H18N2
and a molecular weight of 154.26 g/mol. Its IUPAC name is ethane;(Z)-N-ethyl-2-methyl-N'-methylideneprop-2-ene-1,3-diimine.
Molecular Properties
| Compound Name | ethane;(Z)-N-ethyl-2-methyl-N'-methylideneprop-2-ene-1,3-diimine |
| PubChem CID | 142079882 |
| Molecular Formula | C9H18N2 |
| Molecular Weight | 154.26 g/mol |
| Exact Mass | 154.15 |
| IUPAC Name | ethane;(Z)-N-ethyl-2-methyl-N'-methylideneprop-2-ene-1,3-diimine |
| SMILES | C=N/C=C(C)\C=N\CC.CC |
| InChI | InChI=1S/C7H12N2.C2H6/c1-4-9-6-7(2)5-8-3;1-2/h5-6H,3-4H2,1-2H3;1-2H3/b7-5-,9-6+; |
| InChIKey | KCSQPTYYBCPJNM-UKRQJTKBSA-N |
| XLogP | 2.71 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 154.26 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze ethane;(Z)-N-ethyl-2-methyl-N'-methylideneprop-2-ene-1,3-diimine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;(Z)-N-ethyl-2-methyl-N'-methylideneprop-2-ene-1,3-diimine?
The IUPAC name of ethane;(Z)-N-ethyl-2-methyl-N'-methylideneprop-2-ene-1,3-diimine (CID 142079882) is ethane;(Z)-N-ethyl-2-methyl-N'-methylideneprop-2-ene-1,3-diimine.
What is the SMILES notation for ethane;(Z)-N-ethyl-2-methyl-N'-methylideneprop-2-ene-1,3-diimine?
The canonical SMILES for ethane;(Z)-N-ethyl-2-methyl-N'-methylideneprop-2-ene-1,3-diimine is C=N/C=C(C)\C=N\CC.CC.
What is the InChIKey of ethane;(Z)-N-ethyl-2-methyl-N'-methylideneprop-2-ene-1,3-diimine?
The InChIKey is KCSQPTYYBCPJNM-UKRQJTKBSA-N. The full InChI is InChI=1S/C7H12N2.C2H6/c1-4-9-6-7(2)5-8-3;1-2/h5-6H,3-4H2,1-2H3;1-2H3/b7-5-,9-6+;.
What are the key properties of ethane;(Z)-N-ethyl-2-methyl-N'-methylideneprop-2-ene-1,3-diimine?
ethane;(Z)-N-ethyl-2-methyl-N'-methylideneprop-2-ene-1,3-diimine has a molecular weight of 154.26 g/mol, XLogP of 2.71, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;(Z)-N-ethyl-2-methyl-N'-methylideneprop-2-ene-1,3-diimine is sourced from PubChem (CID 142079882), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).