C16H26O2 — CID 142081323
(2R,5R,5aR)-9a-ethenyl-2,5,6,6-tetramethyl-4,5,5a,7,8,9-hexahydrobenzo[b]oxepin-3-one (PubChem CID 142081323) has the molecular formula C16H26O2 and a molecular weight of 250.38 g/mol. Its IUPAC name is (2R,5R,5aR)-9a-ethenyl-2,5,6,6-tetramethyl-4,5,5a,7,8,9-hexahydrobenzo[b]oxepin-3-one.
| Compound Name | (2R,5R,5aR)-9a-ethenyl-2,5,6,6-tetramethyl-4,5,5a,7,8,9-hexahydrobenzo[b]oxepin-3-one |
|---|---|
| PubChem CID | 142081323 |
| Molecular Formula | C16H26O2 |
| Molecular Weight | 250.38 g/mol |
| Exact Mass | 250.19 |
| IUPAC Name | (2R,5R,5aR)-9a-ethenyl-2,5,6,6-tetramethyl-4,5,5a,7,8,9-hexahydrobenzo[b]oxepin-3-one |
| SMILES | C=CC12CCCC(C)(C)[C@H]1[C@H](C)CC(=O)[C@@H](C)O2 |
| InChI | InChI=1S/C16H26O2/c1-6-16-9-7-8-15(4,5)14(16)11(2)10-13(17)12(3)18-16/h6,11-12,14H,1,7-10H2,2-5H3/t11-,12-,14-,16?/m1/s1 |
| InChIKey | HFNZFUAZECYWIT-XMCAMDJDSA-N |
| XLogP | 3.75 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.38 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|