About 1-[(3Z)-penta-1,3-dien-2-yl]-1,3-dihydro-2-benzofuran-5-carbaldehyde
1-[(3Z)-penta-1,3-dien-2-yl]-1,3-dihydro-2-benzofuran-5-carbaldehyde (PubChem CID 142081440) has the molecular formula C14H14O2
and a molecular weight of 214.26 g/mol. Its IUPAC name is 1-[(3Z)-penta-1,3-dien-2-yl]-1,3-dihydro-2-benzofuran-5-carbaldehyde.
Molecular Properties
| Compound Name | 1-[(3Z)-penta-1,3-dien-2-yl]-1,3-dihydro-2-benzofuran-5-carbaldehyde |
| PubChem CID | 142081440 |
| Molecular Formula | C14H14O2 |
| Molecular Weight | 214.26 g/mol |
| Exact Mass | 214.10 |
| IUPAC Name | 1-[(3Z)-penta-1,3-dien-2-yl]-1,3-dihydro-2-benzofuran-5-carbaldehyde |
| SMILES | C=C(/C=C\C)C1OCc2cc(C=O)ccc21 |
| InChI | InChI=1S/C14H14O2/c1-3-4-10(2)14-13-6-5-11(8-15)7-12(13)9-16-14/h3-8,14H,2,9H2,1H3/b4-3- |
| InChIKey | JNAJQLIIPJERTN-ARJAWSKDSA-N |
| XLogP | 3.20 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 214.26 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 1-[(3Z)-penta-1,3-dien-2-yl]-1,3-dihydro-2-benzofuran-5-carbaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(3Z)-penta-1,3-dien-2-yl]-1,3-dihydro-2-benzofuran-5-carbaldehyde?
The IUPAC name of 1-[(3Z)-penta-1,3-dien-2-yl]-1,3-dihydro-2-benzofuran-5-carbaldehyde (CID 142081440) is 1-[(3Z)-penta-1,3-dien-2-yl]-1,3-dihydro-2-benzofuran-5-carbaldehyde.
What is the SMILES notation for 1-[(3Z)-penta-1,3-dien-2-yl]-1,3-dihydro-2-benzofuran-5-carbaldehyde?
The canonical SMILES for 1-[(3Z)-penta-1,3-dien-2-yl]-1,3-dihydro-2-benzofuran-5-carbaldehyde is C=C(/C=C\C)C1OCc2cc(C=O)ccc21.
What is the InChIKey of 1-[(3Z)-penta-1,3-dien-2-yl]-1,3-dihydro-2-benzofuran-5-carbaldehyde?
The InChIKey is JNAJQLIIPJERTN-ARJAWSKDSA-N. The full InChI is InChI=1S/C14H14O2/c1-3-4-10(2)14-13-6-5-11(8-15)7-12(13)9-16-14/h3-8,14H,2,9H2,1H3/b4-3-.
What are the key properties of 1-[(3Z)-penta-1,3-dien-2-yl]-1,3-dihydro-2-benzofuran-5-carbaldehyde?
1-[(3Z)-penta-1,3-dien-2-yl]-1,3-dihydro-2-benzofuran-5-carbaldehyde has a molecular weight of 214.26 g/mol, XLogP of 3.20, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(3Z)-penta-1,3-dien-2-yl]-1,3-dihydro-2-benzofuran-5-carbaldehyde is sourced from PubChem (CID 142081440), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).