C21H33N3O2 — CID 142082344
N-[(2Z,4E)-1-(4-methyl-6-oxo-4,5-dihydro-1H-pyridazin-3-yl)hepta-2,4-dien-4-yl]cyclooctanecarboxamide (PubChem CID 142082344) has the molecular formula C21H33N3O2 and a molecular weight of 359.51 g/mol. Its IUPAC name is N-[(2Z,4E)-1-(4-methyl-6-oxo-4,5-dihydro-1H-pyridazin-3-yl)hepta-2,4-dien-4-yl]cyclooctanecarboxamide.
| Compound Name | N-[(2Z,4E)-1-(4-methyl-6-oxo-4,5-dihydro-1H-pyridazin-3-yl)hepta-2,4-dien-4-yl]cyclooctanecarboxamide |
|---|---|
| PubChem CID | 142082344 |
| Molecular Formula | C21H33N3O2 |
| Molecular Weight | 359.51 g/mol |
| Exact Mass | 359.26 |
| IUPAC Name | N-[(2Z,4E)-1-(4-methyl-6-oxo-4,5-dihydro-1H-pyridazin-3-yl)hepta-2,4-dien-4-yl]cyclooctanecarboxamide |
| SMILES | CC/C=C(\C=C/CC1=NNC(=O)CC1C)NC(=O)C1CCCCCCC1 |
| InChI | InChI=1S/C21H33N3O2/c1-3-10-18(13-9-14-19-16(2)15-20(25)24-23-19)22-21(26)17-11-7-5-4-6-8-12-17/h9-10,13,16-17H,3-8,11-12,14-15H2,1-2H3,(H,22,26)(H,24,25)/b13-9-,18-10+ |
| InChIKey | HHACQBACZVYNFD-LROCIMMESA-N |
| XLogP | 4.22 |
| TPSA | 70.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.51 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|