C29H27ClN5O2+ — CID 142082504
[(4-chlorophenyl)-[4-[3-[(E)-methoxyiminomethyl]phenyl]-1-methyl-2-oxoquinolin-6-yl]-(3-methylimidazol-4-yl)methyl]azanium (PubChem CID 142082504) has the molecular formula C29H27ClN5O2+ and a molecular weight of 513.02 g/mol. Its IUPAC name is [(4-chlorophenyl)-[4-[3-[(E)-methoxyiminomethyl]phenyl]-1-methyl-2-oxoquinolin-6-yl]-(3-methylimidazol-4-yl)methyl]azanium.
| Compound Name | [(4-chlorophenyl)-[4-[3-[(E)-methoxyiminomethyl]phenyl]-1-methyl-2-oxoquinolin-6-yl]-(3-methylimidazol-4-yl)methyl]azanium |
|---|---|
| PubChem CID | 142082504 |
| Molecular Formula | C29H27ClN5O2+ |
| Molecular Weight | 513.02 g/mol |
| Exact Mass | 512.18 |
| IUPAC Name | [(4-chlorophenyl)-[4-[3-[(E)-methoxyiminomethyl]phenyl]-1-methyl-2-oxoquinolin-6-yl]-(3-methylimidazol-4-yl)methyl]azanium |
| SMILES | CO/N=C/c1cccc(-c2cc(=O)n(C)c3ccc(C([NH3+])(c4ccc(Cl)cc4)c4cncn4C)cc23)c1 |
| InChI | InChI=1S/C29H26ClN5O2/c1-34-18-32-17-27(34)29(31,21-7-10-23(30)11-8-21)22-9-12-26-25(14-22)24(15-28(36)35(26)2)20-6-4-5-19(13-20)16-33-37-3/h4-18H,31H2,1-3H3/p+1/b33-16+ |
| InChIKey | GQAZCTCKSTTZRN-MHDJOFBISA-O |
| XLogP | 4.11 |
| TPSA | 89.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.02 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|