C22H16FN3O2 — CID 14208258
4-fluoro-N-(2-oxo-5-phenyl-1,3-dihydro-1,4-benzodiazepin-3-yl)benzamide (PubChem CID 14208258) has the molecular formula C22H16FN3O2 and a molecular weight of 373.39 g/mol. Its IUPAC name is 4-fluoro-N-(2-oxo-5-phenyl-1,3-dihydro-1,4-benzodiazepin-3-yl)benzamide.
| Compound Name | 4-fluoro-N-(2-oxo-5-phenyl-1,3-dihydro-1,4-benzodiazepin-3-yl)benzamide |
|---|---|
| PubChem CID | 14208258 |
| Molecular Formula | C22H16FN3O2 |
| Molecular Weight | 373.39 g/mol |
| Exact Mass | 373.12 |
| IUPAC Name | 4-fluoro-N-(2-oxo-5-phenyl-1,3-dihydro-1,4-benzodiazepin-3-yl)benzamide |
| SMILES | O=C(NC1N=C(c2ccccc2)c2ccccc2NC1=O)c1ccc(F)cc1 |
| InChI | InChI=1S/C22H16FN3O2/c23-16-12-10-15(11-13-16)21(27)26-20-22(28)24-18-9-5-4-8-17(18)19(25-20)14-6-2-1-3-7-14/h1-13,20H,(H,24,28)(H,26,27) |
| InChIKey | VBUOLEIWYQSODK-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 70.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.39 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |