C20H18ClN3O — CID 142082926
N-(5-chloro-2-pyridinyl)-2-[(4-methylphenyl)methylamino]benzamide (PubChem CID 142082926) has the molecular formula C20H18ClN3O and a molecular weight of 351.84 g/mol. Its IUPAC name is N-(5-chloro-2-pyridinyl)-2-[(4-methylphenyl)methylamino]benzamide.
| Compound Name | N-(5-chloro-2-pyridinyl)-2-[(4-methylphenyl)methylamino]benzamide |
|---|---|
| PubChem CID | 142082926 |
| Molecular Formula | C20H18ClN3O |
| Molecular Weight | 351.84 g/mol |
| Exact Mass | 351.11 |
| IUPAC Name | N-(5-chloro-2-pyridinyl)-2-[(4-methylphenyl)methylamino]benzamide |
| SMILES | Cc1ccc(CNc2ccccc2C(=O)Nc2ccc(Cl)cn2)cc1 |
| InChI | InChI=1S/C20H18ClN3O/c1-14-6-8-15(9-7-14)12-22-18-5-3-2-4-17(18)20(25)24-19-11-10-16(21)13-23-19/h2-11,13,22H,12H2,1H3,(H,23,24,25) |
| InChIKey | QGXYEHQDXFHFRQ-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.84 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |