C10H18N2 — CID 142082929
(2Z)-2-(ethylideneamino)-N,N,4-trimethylpenta-2,4-dien-1-amine (PubChem CID 142082929) has the molecular formula C10H18N2 and a molecular weight of 166.27 g/mol. Its IUPAC name is (2Z)-2-(ethylideneamino)-N,N,4-trimethylpenta-2,4-dien-1-amine.
| Compound Name | (2Z)-2-(ethylideneamino)-N,N,4-trimethylpenta-2,4-dien-1-amine |
|---|---|
| PubChem CID | 142082929 |
| Molecular Formula | C10H18N2 |
| Molecular Weight | 166.27 g/mol |
| Exact Mass | 166.15 |
| IUPAC Name | (2Z)-2-(ethylideneamino)-N,N,4-trimethylpenta-2,4-dien-1-amine |
| SMILES | C=C(C)/C=C(CN(C)C)\N=C\C |
| InChI | InChI=1S/C10H18N2/c1-6-11-10(7-9(2)3)8-12(4)5/h6-7H,2,8H2,1,3-5H3/b10-7-,11-6+ |
| InChIKey | VKHQSTPXSYFJIL-IKVLVDHLSA-N |
| XLogP | 2.10 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 166.27 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|