About N,2-dimethylprop-1-en-1-amine;methanimine
N,2-dimethylprop-1-en-1-amine;methanimine (PubChem CID 142083091) has the molecular formula C6H14N2
and a molecular weight of 114.19 g/mol. Its IUPAC name is N,2-dimethylprop-1-en-1-amine;methanimine.
Molecular Properties
| Compound Name | N,2-dimethylprop-1-en-1-amine;methanimine |
| PubChem CID | 142083091 |
| Molecular Formula | C6H14N2 |
| Molecular Weight | 114.19 g/mol |
| Exact Mass | 114.12 |
| IUPAC Name | N,2-dimethylprop-1-en-1-amine;methanimine |
| SMILES | CNC=C(C)C.[H]N=C |
| InChI | InChI=1S/C5H11N.CH3N/c1-5(2)4-6-3;1-2/h4,6H,1-3H3;2H,1H2 |
| InChIKey | FKRIGYVLLKDUCL-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 35.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 114.19 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze N,2-dimethylprop-1-en-1-amine;methanimine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,2-dimethylprop-1-en-1-amine;methanimine?
The IUPAC name of N,2-dimethylprop-1-en-1-amine;methanimine (CID 142083091) is N,2-dimethylprop-1-en-1-amine;methanimine.
What is the SMILES notation for N,2-dimethylprop-1-en-1-amine;methanimine?
The canonical SMILES for N,2-dimethylprop-1-en-1-amine;methanimine is CNC=C(C)C.[H]N=C.
What is the InChIKey of N,2-dimethylprop-1-en-1-amine;methanimine?
The InChIKey is FKRIGYVLLKDUCL-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H11N.CH3N/c1-5(2)4-6-3;1-2/h4,6H,1-3H3;2H,1H2.
What are the key properties of N,2-dimethylprop-1-en-1-amine;methanimine?
N,2-dimethylprop-1-en-1-amine;methanimine has a molecular weight of 114.19 g/mol, XLogP of 1.40, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N,2-dimethylprop-1-en-1-amine;methanimine is sourced from PubChem (CID 142083091), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).