C27H29F2N5O2 — CID 142083357
4-(N-butyl-N-methylcarbamimidoyl)-N-[2-[(5-ethyl-2-pyridinyl)carbamoyl]-4-fluorophenyl]-2-fluorobenzamide (PubChem CID 142083357) has the molecular formula C27H29F2N5O2 and a molecular weight of 493.56 g/mol. Its IUPAC name is 4-(N-butyl-N-methylcarbamimidoyl)-N-[2-[(5-ethyl-2-pyridinyl)carbamoyl]-4-fluorophenyl]-2-fluorobenzamide.
| Compound Name | 4-(N-butyl-N-methylcarbamimidoyl)-N-[2-[(5-ethyl-2-pyridinyl)carbamoyl]-4-fluorophenyl]-2-fluorobenzamide |
|---|---|
| PubChem CID | 142083357 |
| Molecular Formula | C27H29F2N5O2 |
| Molecular Weight | 493.56 g/mol |
| Exact Mass | 493.23 |
| IUPAC Name | 4-(N-butyl-N-methylcarbamimidoyl)-N-[2-[(5-ethyl-2-pyridinyl)carbamoyl]-4-fluorophenyl]-2-fluorobenzamide |
| SMILES | [H]/N=C(/c1ccc(C(=O)Nc2ccc(F)cc2C(=O)Nc2ccc(CC)cn2)c(F)c1)N(C)CCCC |
| InChI | InChI=1S/C27H29F2N5O2/c1-4-6-13-34(3)25(30)18-8-10-20(22(29)14-18)26(35)32-23-11-9-19(28)15-21(23)27(36)33-24-12-7-17(5-2)16-31-24/h7-12,14-16,30H,4-6,13H2,1-3H3,(H,32,35)(H,31,33,36)/b30-25- |
| InChIKey | HBRHHKDMVPOZOE-JVCXMKTPSA-N |
| XLogP | 5.48 |
| TPSA | 98.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.56 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|