About N-ethylacetamide;N-(2-methoxyethyl)acetamide;methylsulfonylmethane
N-ethylacetamide;N-(2-methoxyethyl)acetamide;methylsulfonylmethane (PubChem CID 142083509) has the molecular formula C11H26N2O5S
and a molecular weight of 298.40 g/mol. Its IUPAC name is N-ethylacetamide;N-(2-methoxyethyl)acetamide;methylsulfonylmethane.
Molecular Properties
| Compound Name | N-ethylacetamide;N-(2-methoxyethyl)acetamide;methylsulfonylmethane |
| PubChem CID | 142083509 |
| Molecular Formula | C11H26N2O5S |
| Molecular Weight | 298.40 g/mol |
| Exact Mass | 298.16 |
| IUPAC Name | N-ethylacetamide;N-(2-methoxyethyl)acetamide;methylsulfonylmethane |
| SMILES | CCNC(C)=O.COCCNC(C)=O.CS(C)(=O)=O |
| InChI | InChI=1S/C5H11NO2.C4H9NO.C2H6O2S/c1-5(7)6-3-4-8-2;1-3-5-4(2)6;1-5(2,3)4/h3-4H2,1-2H3,(H,6,7);3H2,1-2H3,(H,5,6);1-2H3 |
| InChIKey | SNCCTXMLKAWKLY-UHFFFAOYSA-N |
| XLogP | -0.43 |
| TPSA | 101.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 298.40 |
| LogP ≤ 5 | -0.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N-ethylacetamide;N-(2-methoxyethyl)acetamide;methylsulfonylmethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-ethylacetamide;N-(2-methoxyethyl)acetamide;methylsulfonylmethane?
The IUPAC name of N-ethylacetamide;N-(2-methoxyethyl)acetamide;methylsulfonylmethane (CID 142083509) is N-ethylacetamide;N-(2-methoxyethyl)acetamide;methylsulfonylmethane.
What is the SMILES notation for N-ethylacetamide;N-(2-methoxyethyl)acetamide;methylsulfonylmethane?
The canonical SMILES for N-ethylacetamide;N-(2-methoxyethyl)acetamide;methylsulfonylmethane is CCNC(C)=O.COCCNC(C)=O.CS(C)(=O)=O.
What is the InChIKey of N-ethylacetamide;N-(2-methoxyethyl)acetamide;methylsulfonylmethane?
The InChIKey is SNCCTXMLKAWKLY-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H11NO2.C4H9NO.C2H6O2S/c1-5(7)6-3-4-8-2;1-3-5-4(2)6;1-5(2,3)4/h3-4H2,1-2H3,(H,6,7);3H2,1-2H3,(H,5,6);1-2H3.
What are the key properties of N-ethylacetamide;N-(2-methoxyethyl)acetamide;methylsulfonylmethane?
N-ethylacetamide;N-(2-methoxyethyl)acetamide;methylsulfonylmethane has a molecular weight of 298.40 g/mol, XLogP of -0.43, 4 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-ethylacetamide;N-(2-methoxyethyl)acetamide;methylsulfonylmethane is sourced from PubChem (CID 142083509), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).