C18H31NOS — CID 142083736
ethane;4-[(1E)-3-methoxy-2,6-dimethylhepta-1,5-dienyl]-2-propyl-1,3-thiazole (PubChem CID 142083736) has the molecular formula C18H31NOS and a molecular weight of 309.52 g/mol. Its IUPAC name is ethane;4-[(1E)-3-methoxy-2,6-dimethylhepta-1,5-dienyl]-2-propyl-1,3-thiazole.
| Compound Name | ethane;4-[(1E)-3-methoxy-2,6-dimethylhepta-1,5-dienyl]-2-propyl-1,3-thiazole |
|---|---|
| PubChem CID | 142083736 |
| Molecular Formula | C18H31NOS |
| Molecular Weight | 309.52 g/mol |
| Exact Mass | 309.21 |
| IUPAC Name | ethane;4-[(1E)-3-methoxy-2,6-dimethylhepta-1,5-dienyl]-2-propyl-1,3-thiazole |
| SMILES | CC.CCCc1nc(/C=C(\C)C(CC=C(C)C)OC)cs1 |
| InChI | InChI=1S/C16H25NOS.C2H6/c1-6-7-16-17-14(11-19-16)10-13(4)15(18-5)9-8-12(2)3;1-2/h8,10-11,15H,6-7,9H2,1-5H3;1-2H3/b13-10+; |
| InChIKey | FQNOIUIMZHLBMV-RSGUCCNWSA-N |
| XLogP | 5.90 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.52 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|