C26H38INO6S — CID 142083739
(4S,7R,8S,9S,13Z,16S)-4,8-dihydroxy-16-[(E)-1-[2-(hydroxymethyl)-1,3-thiazol-4-yl]prop-1-en-2-yl]-7-iodo-5,5,9,13-tetramethyl-1-oxacyclohexadec-13-ene-2,6-dione (PubChem CID 142083739) has the molecular formula C26H38INO6S and a molecular weight of 619.56 g/mol. Its IUPAC name is (4S,7R,8S,9S,13Z,16S)-4,8-dihydroxy-16-[(E)-1-[2-(hydroxymethyl)-1,3-thiazol-4-yl]prop-1-en-2-yl]-7-iodo-5,5,9,13-tetramethyl-1-oxacyclohexadec-13-ene-2,6-dione.
| Compound Name | (4S,7R,8S,9S,13Z,16S)-4,8-dihydroxy-16-[(E)-1-[2-(hydroxymethyl)-1,3-thiazol-4-yl]prop-1-en-2-yl]-7-iodo-5,5,9,13-tetramethyl-1-oxacyclohexadec-13-ene-2,6-dione |
|---|---|
| PubChem CID | 142083739 |
| Molecular Formula | C26H38INO6S |
| Molecular Weight | 619.56 g/mol |
| Exact Mass | 619.15 |
| IUPAC Name | (4S,7R,8S,9S,13Z,16S)-4,8-dihydroxy-16-[(E)-1-[2-(hydroxymethyl)-1,3-thiazol-4-yl]prop-1-en-2-yl]-7-iodo-5,5,9,13-tetramethyl-1-oxacyclohexadec-13-ene-2,6-dione |
| SMILES | C/C1=C/C[C@@H](/C(C)=C/c2csc(CO)n2)OC(=O)C[C@H](O)C(C)(C)C(=O)[C@H](I)[C@@H](O)[C@@H](C)CCC1 |
| InChI | InChI=1S/C26H38INO6S/c1-15-7-6-8-16(2)24(32)23(27)25(33)26(4,5)20(30)12-22(31)34-19(10-9-15)17(3)11-18-14-35-21(13-29)28-18/h9,11,14,16,19-20,23-24,29-30,32H,6-8,10,12-13H2,1-5H3/b15-9-,17-11+/t16-,19-,20-,23+,24-/m0/s1 |
| InChIKey | RESOSXUUJLZPSW-VZYHVBDVSA-N |
| XLogP | 4.62 |
| TPSA | 116.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 619.56 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|