C27H45N3 — CID 142084595
ethane;N'-methyl-N-[1-[(4E,6Z,8Z)-3-methyldeca-4,6,8-trienyl]piperidin-4-yl]-N-[(3Z)-5-methylhexa-1,3,5-trien-2-yl]methanimidamide (PubChem CID 142084595) has the molecular formula C27H45N3 and a molecular weight of 411.68 g/mol. Its IUPAC name is ethane;N'-methyl-N-[1-[(4E,6Z,8Z)-3-methyldeca-4,6,8-trienyl]piperidin-4-yl]-N-[(3Z)-5-methylhexa-1,3,5-trien-2-yl]methanimidamide.
| Compound Name | ethane;N'-methyl-N-[1-[(4E,6Z,8Z)-3-methyldeca-4,6,8-trienyl]piperidin-4-yl]-N-[(3Z)-5-methylhexa-1,3,5-trien-2-yl]methanimidamide |
|---|---|
| PubChem CID | 142084595 |
| Molecular Formula | C27H45N3 |
| Molecular Weight | 411.68 g/mol |
| Exact Mass | 411.36 |
| IUPAC Name | ethane;N'-methyl-N-[1-[(4E,6Z,8Z)-3-methyldeca-4,6,8-trienyl]piperidin-4-yl]-N-[(3Z)-5-methylhexa-1,3,5-trien-2-yl]methanimidamide |
| SMILES | C=C(C)/C=C\C(=C)N(/C=N/C)C1CCN(CCC(C)/C=C/C=C\C=C/C)CC1.CC |
| InChI | InChI=1S/C25H39N3.C2H6/c1-7-8-9-10-11-12-23(4)15-18-27-19-16-25(17-20-27)28(21-26-6)24(5)14-13-22(2)3;1-2/h7-14,21,23,25H,2,5,15-20H2,1,3-4,6H3;1-2H3/b8-7-,10-9-,12-11+,14-13-,26-21+; |
| InChIKey | DGXXUJYCRWKXOR-JSZPHQGVSA-N |
| XLogP | 6.80 |
| TPSA | 18.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.68 |
| LogP ≤ 5 | 6.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|