C20H30N2O — CID 142085492
2-(benzylamino)-2-[(1R)-3-methyl-1-bicyclo[3.3.1]nonanyl]acetonitrile;methanol (PubChem CID 142085492) has the molecular formula C20H30N2O and a molecular weight of 314.47 g/mol. Its IUPAC name is 2-(benzylamino)-2-[(1R)-3-methyl-1-bicyclo[3.3.1]nonanyl]acetonitrile;methanol.
| Compound Name | 2-(benzylamino)-2-[(1R)-3-methyl-1-bicyclo[3.3.1]nonanyl]acetonitrile;methanol |
|---|---|
| PubChem CID | 142085492 |
| Molecular Formula | C20H30N2O |
| Molecular Weight | 314.47 g/mol |
| Exact Mass | 314.24 |
| IUPAC Name | 2-(benzylamino)-2-[(1R)-3-methyl-1-bicyclo[3.3.1]nonanyl]acetonitrile;methanol |
| SMILES | CC1CC2CCC[C@@](C(C#N)NCc3ccccc3)(C1)C2.CO |
| InChI | InChI=1S/C19H26N2.CH4O/c1-15-10-17-8-5-9-19(11-15,12-17)18(13-20)21-14-16-6-3-2-4-7-16;1-2/h2-4,6-7,15,17-18,21H,5,8-12,14H2,1H3;2H,1H3/t15?,17?,18?,19-;/m1./s1 |
| InChIKey | PPJDHUNDOYQFPL-WPABQNJSSA-N |
| XLogP | 3.88 |
| TPSA | 56.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.47 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |