C22H24F4N2O4S — CID 142085869
1-[5-[(Z)-1-[3,4-bis(difluoromethoxy)phenyl]-3-[(Z)-2-(hydroxyamino)ethenyl]pent-3-enyl]-1,3-thiazol-2-yl]cyclobutan-1-ol (PubChem CID 142085869) has the molecular formula C22H24F4N2O4S and a molecular weight of 488.50 g/mol. Its IUPAC name is 1-[5-[(Z)-1-[3,4-bis(difluoromethoxy)phenyl]-3-[(Z)-2-(hydroxyamino)ethenyl]pent-3-enyl]-1,3-thiazol-2-yl]cyclobutan-1-ol.
| Compound Name | 1-[5-[(Z)-1-[3,4-bis(difluoromethoxy)phenyl]-3-[(Z)-2-(hydroxyamino)ethenyl]pent-3-enyl]-1,3-thiazol-2-yl]cyclobutan-1-ol |
|---|---|
| PubChem CID | 142085869 |
| Molecular Formula | C22H24F4N2O4S |
| Molecular Weight | 488.50 g/mol |
| Exact Mass | 488.14 |
| IUPAC Name | 1-[5-[(Z)-1-[3,4-bis(difluoromethoxy)phenyl]-3-[(Z)-2-(hydroxyamino)ethenyl]pent-3-enyl]-1,3-thiazol-2-yl]cyclobutan-1-ol |
| SMILES | C/C=C(\C=C/NO)CC(c1ccc(OC(F)F)c(OC(F)F)c1)c1cnc(C2(O)CCC2)s1 |
| InChI | InChI=1S/C22H24F4N2O4S/c1-2-13(6-9-28-30)10-15(18-12-27-19(33-18)22(29)7-3-8-22)14-4-5-16(31-20(23)24)17(11-14)32-21(25)26/h2,4-6,9,11-12,15,20-21,28-30H,3,7-8,10H2,1H3/b9-6-,13-2+ |
| InChIKey | XDUWSBDVKGBBNB-RZFCOJNSSA-N |
| XLogP | 5.68 |
| TPSA | 83.84 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.50 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|