C24H23F8N2O4S+ — CID 142085880
(E)-[(2Z,4E)-7-[3-cyclobutyloxy-4-(difluoromethoxy)phenyl]-7-[2-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-1,3-thiazol-5-yl]hepta-2,4-dienylidene]-hydroxyazanium (PubChem CID 142085880) has the molecular formula C24H23F8N2O4S+ and a molecular weight of 587.51 g/mol. Its IUPAC name is (E)-[(2Z,4E)-7-[3-cyclobutyloxy-4-(difluoromethoxy)phenyl]-7-[2-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-1,3-thiazol-5-yl]hepta-2,4-dienylidene]-hydroxyazanium.
| Compound Name | (E)-[(2Z,4E)-7-[3-cyclobutyloxy-4-(difluoromethoxy)phenyl]-7-[2-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-1,3-thiazol-5-yl]hepta-2,4-dienylidene]-hydroxyazanium |
|---|---|
| PubChem CID | 142085880 |
| Molecular Formula | C24H23F8N2O4S+ |
| Molecular Weight | 587.51 g/mol |
| Exact Mass | 587.12 |
| IUPAC Name | (E)-[(2Z,4E)-7-[3-cyclobutyloxy-4-(difluoromethoxy)phenyl]-7-[2-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-1,3-thiazol-5-yl]hepta-2,4-dienylidene]-hydroxyazanium |
| SMILES | O/[NH+]=C/C=C\C=C\CC(c1ccc(OC(F)F)c(OC2CCC2)c1)c1cnc(C(O)(C(F)(F)F)C(F)(F)F)s1 |
| InChI | InChI=1S/C24H22F8N2O4S/c25-21(26)38-17-10-9-14(12-18(17)37-15-6-5-7-15)16(8-3-1-2-4-11-34-36)19-13-33-20(39-19)22(35,23(27,28)29)24(30,31)32/h1-4,9-13,15-16,21,35-36H,5-8H2/p+1/b3-1+,4-2-,34-11+ |
| InChIKey | PSUQNZSOTOETQB-ONBFEPMCSA-O |
| XLogP | 5.16 |
| TPSA | 85.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 587.51 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|