C24H31F2N2O4S+ — CID 142085889
[(1Z,3Z)-3-[2-[3-cyclobutyloxy-4-(difluoromethoxy)phenyl]-2-[2-(2-hydroxypropan-2-yl)-1,3-thiazol-5-yl]ethyl]penta-1,3-dienyl]-hydroxyazanium (PubChem CID 142085889) has the molecular formula C24H31F2N2O4S+ and a molecular weight of 481.59 g/mol. Its IUPAC name is [(1Z,3Z)-3-[2-[3-cyclobutyloxy-4-(difluoromethoxy)phenyl]-2-[2-(2-hydroxypropan-2-yl)-1,3-thiazol-5-yl]ethyl]penta-1,3-dienyl]-hydroxyazanium.
| Compound Name | [(1Z,3Z)-3-[2-[3-cyclobutyloxy-4-(difluoromethoxy)phenyl]-2-[2-(2-hydroxypropan-2-yl)-1,3-thiazol-5-yl]ethyl]penta-1,3-dienyl]-hydroxyazanium |
|---|---|
| PubChem CID | 142085889 |
| Molecular Formula | C24H31F2N2O4S+ |
| Molecular Weight | 481.59 g/mol |
| Exact Mass | 481.20 |
| IUPAC Name | [(1Z,3Z)-3-[2-[3-cyclobutyloxy-4-(difluoromethoxy)phenyl]-2-[2-(2-hydroxypropan-2-yl)-1,3-thiazol-5-yl]ethyl]penta-1,3-dienyl]-hydroxyazanium |
| SMILES | C/C=C(\C=C/[NH2+]O)CC(c1ccc(OC(F)F)c(OC2CCC2)c1)c1cnc(C(C)(C)O)s1 |
| InChI | InChI=1S/C24H30F2N2O4S/c1-4-15(10-11-28-30)12-18(21-14-27-22(33-21)24(2,3)29)16-8-9-19(32-23(25)26)20(13-16)31-17-6-5-7-17/h4,8-11,13-14,17-18,23,28-30H,5-7,12H2,1-3H3/p+1/b11-10-,15-4+ |
| InChIKey | HYJCVBANPOWHOE-NPDUJFAESA-O |
| XLogP | 4.84 |
| TPSA | 88.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.59 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|