C18H22BrF2O3PS — CID 142085995
[[2-bromo-4-[4-[(3Z)-4-methylhexa-1,3,5-trien-2-yl]sulfanylbutyl]phenyl]-difluoromethyl]phosphonic acid (PubChem CID 142085995) has the molecular formula C18H22BrF2O3PS and a molecular weight of 467.31 g/mol. Its IUPAC name is [[2-bromo-4-[4-[(3Z)-4-methylhexa-1,3,5-trien-2-yl]sulfanylbutyl]phenyl]-difluoromethyl]phosphonic acid.
| Compound Name | [[2-bromo-4-[4-[(3Z)-4-methylhexa-1,3,5-trien-2-yl]sulfanylbutyl]phenyl]-difluoromethyl]phosphonic acid |
|---|---|
| PubChem CID | 142085995 |
| Molecular Formula | C18H22BrF2O3PS |
| Molecular Weight | 467.31 g/mol |
| Exact Mass | 466.02 |
| IUPAC Name | [[2-bromo-4-[4-[(3Z)-4-methylhexa-1,3,5-trien-2-yl]sulfanylbutyl]phenyl]-difluoromethyl]phosphonic acid |
| SMILES | C=C/C(C)=C\C(=C)SCCCCc1ccc(C(F)(F)P(=O)(O)O)c(Br)c1 |
| InChI | InChI=1S/C18H22BrF2O3PS/c1-4-13(2)11-14(3)26-10-6-5-7-15-8-9-16(17(19)12-15)18(20,21)25(22,23)24/h4,8-9,11-12H,1,3,5-7,10H2,2H3,(H2,22,23,24)/b13-11- |
| InChIKey | DOXCZNAEZZMHMG-QBFSEMIESA-N |
| XLogP | 6.38 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.31 |
| LogP ≤ 5 | 6.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|