About (2Z,4Z)-N-tert-butyl-2-(4-methylphenyl)hepta-2,4-diene-3-sulfonamide
(2Z,4Z)-N-tert-butyl-2-(4-methylphenyl)hepta-2,4-diene-3-sulfonamide (PubChem CID 142086004) has the molecular formula C18H27NO2S
and a molecular weight of 321.49 g/mol. Its IUPAC name is (2Z,4Z)-N-tert-butyl-2-(4-methylphenyl)hepta-2,4-diene-3-sulfonamide.
Molecular Properties
| Compound Name | (2Z,4Z)-N-tert-butyl-2-(4-methylphenyl)hepta-2,4-diene-3-sulfonamide |
| PubChem CID | 142086004 |
| Molecular Formula | C18H27NO2S |
| Molecular Weight | 321.49 g/mol |
| Exact Mass | 321.18 |
| IUPAC Name | (2Z,4Z)-N-tert-butyl-2-(4-methylphenyl)hepta-2,4-diene-3-sulfonamide |
| SMILES | CC/C=C\C(=C(/C)c1ccc(C)cc1)S(=O)(=O)NC(C)(C)C |
| InChI | InChI=1S/C18H27NO2S/c1-7-8-9-17(22(20,21)19-18(4,5)6)15(3)16-12-10-14(2)11-13-16/h8-13,19H,7H2,1-6H3/b9-8-,17-15- |
| InChIKey | ITABLEUBCCSKIZ-YTZRPQLRSA-N |
| XLogP | 4.41 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 321.49 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze (2Z,4Z)-N-tert-butyl-2-(4-methylphenyl)hepta-2,4-diene-3-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2Z,4Z)-N-tert-butyl-2-(4-methylphenyl)hepta-2,4-diene-3-sulfonamide?
The IUPAC name of (2Z,4Z)-N-tert-butyl-2-(4-methylphenyl)hepta-2,4-diene-3-sulfonamide (CID 142086004) is (2Z,4Z)-N-tert-butyl-2-(4-methylphenyl)hepta-2,4-diene-3-sulfonamide.
What is the SMILES notation for (2Z,4Z)-N-tert-butyl-2-(4-methylphenyl)hepta-2,4-diene-3-sulfonamide?
The canonical SMILES for (2Z,4Z)-N-tert-butyl-2-(4-methylphenyl)hepta-2,4-diene-3-sulfonamide is CC/C=C\C(=C(/C)c1ccc(C)cc1)S(=O)(=O)NC(C)(C)C.
What is the InChIKey of (2Z,4Z)-N-tert-butyl-2-(4-methylphenyl)hepta-2,4-diene-3-sulfonamide?
The InChIKey is ITABLEUBCCSKIZ-YTZRPQLRSA-N. The full InChI is InChI=1S/C18H27NO2S/c1-7-8-9-17(22(20,21)19-18(4,5)6)15(3)16-12-10-14(2)11-13-16/h8-13,19H,7H2,1-6H3/b9-8-,17-15-.
What are the key properties of (2Z,4Z)-N-tert-butyl-2-(4-methylphenyl)hepta-2,4-diene-3-sulfonamide?
(2Z,4Z)-N-tert-butyl-2-(4-methylphenyl)hepta-2,4-diene-3-sulfonamide has a molecular weight of 321.49 g/mol, XLogP of 4.41, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2Z,4Z)-N-tert-butyl-2-(4-methylphenyl)hepta-2,4-diene-3-sulfonamide is sourced from PubChem (CID 142086004), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).