C26H38N2O — CID 142086759
8-[[(2E,4E)-4-aminohexa-2,4-dien-3-yl]amino]-1-naphthalen-2-yloctan-1-one;ethane (PubChem CID 142086759) has the molecular formula C26H38N2O and a molecular weight of 394.60 g/mol. Its IUPAC name is 8-[[(2E,4E)-4-aminohexa-2,4-dien-3-yl]amino]-1-naphthalen-2-yloctan-1-one;ethane.
| Compound Name | 8-[[(2E,4E)-4-aminohexa-2,4-dien-3-yl]amino]-1-naphthalen-2-yloctan-1-one;ethane |
|---|---|
| PubChem CID | 142086759 |
| Molecular Formula | C26H38N2O |
| Molecular Weight | 394.60 g/mol |
| Exact Mass | 394.30 |
| IUPAC Name | 8-[[(2E,4E)-4-aminohexa-2,4-dien-3-yl]amino]-1-naphthalen-2-yloctan-1-one;ethane |
| SMILES | C/C=C(N)\C(=C/C)NCCCCCCCC(=O)c1ccc2ccccc2c1.CC |
| InChI | InChI=1S/C24H32N2O.C2H6/c1-3-22(25)23(4-2)26-17-11-7-5-6-8-14-24(27)21-16-15-19-12-9-10-13-20(19)18-21;1-2/h3-4,9-10,12-13,15-16,18,26H,5-8,11,14,17,25H2,1-2H3;1-2H3/b22-3+,23-4+; |
| InChIKey | WOWSROFGMGCOJH-YDHBEELSSA-N |
| XLogP | 6.75 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.60 |
| LogP ≤ 5 | 6.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|