C27H38O3 — CID 142086802
2-(7-cyclobutylidene-7-ethoxyheptyl)-2-[(4E)-4-[(2Z)-penta-2,4-dienylidene]cyclohexa-1,5-dien-1-yl]-1,3-dioxolane (PubChem CID 142086802) has the molecular formula C27H38O3 and a molecular weight of 410.60 g/mol. Its IUPAC name is 2-(7-cyclobutylidene-7-ethoxyheptyl)-2-[(4E)-4-[(2Z)-penta-2,4-dienylidene]cyclohexa-1,5-dien-1-yl]-1,3-dioxolane.
| Compound Name | 2-(7-cyclobutylidene-7-ethoxyheptyl)-2-[(4E)-4-[(2Z)-penta-2,4-dienylidene]cyclohexa-1,5-dien-1-yl]-1,3-dioxolane |
|---|---|
| PubChem CID | 142086802 |
| Molecular Formula | C27H38O3 |
| Molecular Weight | 410.60 g/mol |
| Exact Mass | 410.28 |
| IUPAC Name | 2-(7-cyclobutylidene-7-ethoxyheptyl)-2-[(4E)-4-[(2Z)-penta-2,4-dienylidene]cyclohexa-1,5-dien-1-yl]-1,3-dioxolane |
| SMILES | C=C/C=C\C=C1\C=CC(C2(CCCCCCC(OCC)=C3CCC3)OCCO2)=CC1 |
| InChI | InChI=1S/C27H38O3/c1-3-5-8-12-23-16-18-25(19-17-23)27(29-21-22-30-27)20-10-7-6-9-15-26(28-4-2)24-13-11-14-24/h3,5,8,12,16,18-19H,1,4,6-7,9-11,13-15,17,20-22H2,2H3/b8-5-,23-12- |
| InChIKey | ITBOKDGOYPFNKN-YJYODBAJSA-N |
| XLogP | 7.10 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.60 |
| LogP ≤ 5 | 7.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|