About (Z)-N-[2-(1,3-dioxan-2-yl)ethyl]-1-methylsulfanyl-2-nitroethenamine
(Z)-N-[2-(1,3-dioxan-2-yl)ethyl]-1-methylsulfanyl-2-nitroethenamine (PubChem CID 142086847) has the molecular formula C9H16N2O4S
and a molecular weight of 248.30 g/mol. Its IUPAC name is (Z)-N-[2-(1,3-dioxan-2-yl)ethyl]-1-methylsulfanyl-2-nitroethenamine.
Molecular Properties
| Compound Name | (Z)-N-[2-(1,3-dioxan-2-yl)ethyl]-1-methylsulfanyl-2-nitroethenamine |
| PubChem CID | 142086847 |
| Molecular Formula | C9H16N2O4S |
| Molecular Weight | 248.30 g/mol |
| Exact Mass | 248.08 |
| IUPAC Name | (Z)-N-[2-(1,3-dioxan-2-yl)ethyl]-1-methylsulfanyl-2-nitroethenamine |
| SMILES | CS/C(=C\[N+](=O)[O-])NCCC1OCCCO1 |
| InChI | InChI=1S/C9H16N2O4S/c1-16-8(7-11(12)13)10-4-3-9-14-5-2-6-15-9/h7,9-10H,2-6H2,1H3/b8-7- |
| InChIKey | SMFMGGVMABCYKB-FPLPWBNLSA-N |
| XLogP | 1.17 |
| TPSA | 73.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 248.30 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (Z)-N-[2-(1,3-dioxan-2-yl)ethyl]-1-methylsulfanyl-2-nitroethenamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-N-[2-(1,3-dioxan-2-yl)ethyl]-1-methylsulfanyl-2-nitroethenamine?
The IUPAC name of (Z)-N-[2-(1,3-dioxan-2-yl)ethyl]-1-methylsulfanyl-2-nitroethenamine (CID 142086847) is (Z)-N-[2-(1,3-dioxan-2-yl)ethyl]-1-methylsulfanyl-2-nitroethenamine.
What is the SMILES notation for (Z)-N-[2-(1,3-dioxan-2-yl)ethyl]-1-methylsulfanyl-2-nitroethenamine?
The canonical SMILES for (Z)-N-[2-(1,3-dioxan-2-yl)ethyl]-1-methylsulfanyl-2-nitroethenamine is CS/C(=C\[N+](=O)[O-])NCCC1OCCCO1.
What is the InChIKey of (Z)-N-[2-(1,3-dioxan-2-yl)ethyl]-1-methylsulfanyl-2-nitroethenamine?
The InChIKey is SMFMGGVMABCYKB-FPLPWBNLSA-N. The full InChI is InChI=1S/C9H16N2O4S/c1-16-8(7-11(12)13)10-4-3-9-14-5-2-6-15-9/h7,9-10H,2-6H2,1H3/b8-7-.
What are the key properties of (Z)-N-[2-(1,3-dioxan-2-yl)ethyl]-1-methylsulfanyl-2-nitroethenamine?
(Z)-N-[2-(1,3-dioxan-2-yl)ethyl]-1-methylsulfanyl-2-nitroethenamine has a molecular weight of 248.30 g/mol, XLogP of 1.17, 6 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-N-[2-(1,3-dioxan-2-yl)ethyl]-1-methylsulfanyl-2-nitroethenamine is sourced from PubChem (CID 142086847), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).